C29H23F7N2O3 — CID 46884472
(1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(1-oxidopyridin-1-ium-3-yl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 46884472) has the molecular formula C29H23F7N2O3 and a molecular weight of 580.50 g/mol. Its IUPAC name is (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(1-oxidopyridin-1-ium-3-yl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(1-oxidopyridin-1-ium-3-yl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 46884472 |
| Molecular Formula | C29H23F7N2O3 |
| Molecular Weight | 580.50 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(1-oxidopyridin-1-ium-3-yl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)C=C(c3ccc[n+]([O-])c3)CC2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H23F7N2O3/c1-16(19-9-21(28(31,32)33)13-22(10-19)29(34,35)36)41-25-15-38-24(27(25)17-4-6-23(30)7-5-17)11-20(12-26(38)39)18-3-2-8-37(40)14-18/h2-10,12-14,16,24-25,27H,11,15H2,1H3/t16-,24?,25+,27+/m1/s1 |
| InChIKey | KYBKBJIPIVZNKG-SAYLLPIZSA-N |
| XLogP | 6.42 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|