C25H30N8O3 — CID 46884549
1-[4-[4,6-bis[(3R)-3-methylmorpholin-4-yl]-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea (PubChem CID 46884549) has the molecular formula C25H30N8O3 and a molecular weight of 490.57 g/mol. Its IUPAC name is 1-[4-[4,6-bis[(3R)-3-methylmorpholin-4-yl]-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[4-[4,6-bis[(3R)-3-methylmorpholin-4-yl]-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 46884549 |
| Molecular Formula | C25H30N8O3 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 1-[4-[4,6-bis[(3R)-3-methylmorpholin-4-yl]-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea |
| SMILES | C[C@@H]1COCCN1c1nc(-c2ccc(NC(=O)Nc3cccnc3)cc2)nc(N2CCOC[C@H]2C)n1 |
| InChI | InChI=1S/C25H30N8O3/c1-17-15-35-12-10-32(17)23-29-22(30-24(31-23)33-11-13-36-16-18(33)2)19-5-7-20(8-6-19)27-25(34)28-21-4-3-9-26-14-21/h3-9,14,17-18H,10-13,15-16H2,1-2H3,(H2,27,28,34)/t17-,18-/m1/s1 |
| InChIKey | VIICPZNFKCGPJK-QZTJIDSGSA-N |
| XLogP | 3.03 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |