C31H40N8O3 — CID 46884592
1-[4-[4-[(3R)-3-methylmorpholin-4-yl]-6-(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 46884592) has the molecular formula C31H40N8O3 and a molecular weight of 572.71 g/mol. Its IUPAC name is 1-[4-[4-[(3R)-3-methylmorpholin-4-yl]-6-(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[4-[4-[(3R)-3-methylmorpholin-4-yl]-6-(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 46884592 |
| Molecular Formula | C31H40N8O3 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | 1-[4-[4-[(3R)-3-methylmorpholin-4-yl]-6-(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | C[C@@H]1COCCN1c1nc(-c2ccc(NC(=O)Nc3ccc(N4CCN(C)CC4)cc3)cc2)nc(C2CCOCC2)n1 |
| InChI | InChI=1S/C31H40N8O3/c1-22-21-42-20-17-39(22)30-35-28(34-29(36-30)24-11-18-41-19-12-24)23-3-5-25(6-4-23)32-31(40)33-26-7-9-27(10-8-26)38-15-13-37(2)14-16-38/h3-10,22,24H,11-21H2,1-2H3,(H2,32,33,40)/t22-/m1/s1 |
| InChIKey | LCENFJFNEOFBCJ-JOCHJYFZSA-N |
| XLogP | 4.05 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|