C30H38N8O3 — CID 46884593
1-[4-[4-[(3R)-3-methylmorpholin-4-yl]-6-(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]-3-(4-piperazin-1-ylphenyl)urea (PubChem CID 46884593) has the molecular formula C30H38N8O3 and a molecular weight of 558.69 g/mol. Its IUPAC name is 1-[4-[4-[(3R)-3-methylmorpholin-4-yl]-6-(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]-3-(4-piperazin-1-ylphenyl)urea.
| Compound Name | 1-[4-[4-[(3R)-3-methylmorpholin-4-yl]-6-(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]-3-(4-piperazin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 46884593 |
| Molecular Formula | C30H38N8O3 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 1-[4-[4-[(3R)-3-methylmorpholin-4-yl]-6-(oxan-4-yl)-1,3,5-triazin-2-yl]phenyl]-3-(4-piperazin-1-ylphenyl)urea |
| SMILES | C[C@@H]1COCCN1c1nc(-c2ccc(NC(=O)Nc3ccc(N4CCNCC4)cc3)cc2)nc(C2CCOCC2)n1 |
| InChI | InChI=1S/C30H38N8O3/c1-21-20-41-19-16-38(21)29-35-27(34-28(36-29)23-10-17-40-18-11-23)22-2-4-24(5-3-22)32-30(39)33-25-6-8-26(9-7-25)37-14-12-31-13-15-37/h2-9,21,23,31H,10-20H2,1H3,(H2,32,33,39)/t21-/m1/s1 |
| InChIKey | GYCIIGYCIFEYFA-OAQYLSRUSA-N |
| XLogP | 3.71 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|