C32H43N7O — CID 46884676
N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7-propan-2-ylpurin-6-amine (PubChem CID 46884676) has the molecular formula C32H43N7O and a molecular weight of 541.74 g/mol. Its IUPAC name is N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7-propan-2-ylpurin-6-amine.
| Compound Name | N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 46884676 |
| Molecular Formula | C32H43N7O |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.35 |
| IUPAC Name | N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7-propan-2-ylpurin-6-amine |
| SMILES | COc1ccc(N2CCN(c3nc(Nc4cc(C(C)(C)C)ccc4C)c4c(ncn4C(C)C)n3)CC2(C)C)cc1 |
| InChI | InChI=1S/C32H43N7O/c1-21(2)38-20-33-28-27(38)29(34-26-18-23(31(4,5)6)11-10-22(26)3)36-30(35-28)37-16-17-39(32(7,8)19-37)24-12-14-25(40-9)15-13-24/h10-15,18,20-21H,16-17,19H2,1-9H3,(H,34,35,36) |
| InChIKey | VAEZRZMYYUGCFP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|