C31H41N7O — CID 46884678
N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7,8-dimethylpurin-6-amine (PubChem CID 46884678) has the molecular formula C31H41N7O and a molecular weight of 527.72 g/mol. Its IUPAC name is N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7,8-dimethylpurin-6-amine.
| Compound Name | N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7,8-dimethylpurin-6-amine |
|---|---|
| PubChem CID | 46884678 |
| Molecular Formula | C31H41N7O |
| Molecular Weight | 527.72 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7,8-dimethylpurin-6-amine |
| SMILES | COc1ccc(N2CCN(c3nc(Nc4cc(C(C)(C)C)ccc4C)c4c(n3)nc(C)n4C)CC2(C)C)cc1 |
| InChI | InChI=1S/C31H41N7O/c1-20-10-11-22(30(3,4)5)18-25(20)33-28-26-27(32-21(2)36(26)8)34-29(35-28)37-16-17-38(31(6,7)19-37)23-12-14-24(39-9)15-13-23/h10-15,18H,16-17,19H2,1-9H3,(H,33,34,35) |
| InChIKey | NHPMSJGFXUIGKO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.72 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|