C22H27NO5 — CID 46884692
methyl (3R,7S,7aR)-3-tert-butyl-7-hydroxy-6,6-dimethyl-5-oxo-7-(2-phenylethynyl)-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 46884692) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is methyl (3R,7S,7aR)-3-tert-butyl-7-hydroxy-6,6-dimethyl-5-oxo-7-(2-phenylethynyl)-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3R,7S,7aR)-3-tert-butyl-7-hydroxy-6,6-dimethyl-5-oxo-7-(2-phenylethynyl)-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 46884692 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | methyl (3R,7S,7aR)-3-tert-butyl-7-hydroxy-6,6-dimethyl-5-oxo-7-(2-phenylethynyl)-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)C(C)(C)[C@@]2(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C22H27NO5/c1-19(2,3)17-23-16(24)20(4,5)22(26,13-12-15-10-8-7-9-11-15)21(23,14-28-17)18(25)27-6/h7-11,17,26H,14H2,1-6H3/t17-,21+,22+/m1/s1 |
| InChIKey | NHSLMWQPUNNOGE-WTNAPCKOSA-N |
| XLogP | 1.95 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|