C28H38N2O7 — CID 46884694
methyl (3R,7S,7aR)-3-tert-butyl-7-hydroxy-7-[3-[(3-hydroxy-2,2-dimethyl-3-phenylpropanoyl)amino]prop-1-ynyl]-6,6-dimethyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 46884694) has the molecular formula C28H38N2O7 and a molecular weight of 514.62 g/mol. Its IUPAC name is methyl (3R,7S,7aR)-3-tert-butyl-7-hydroxy-7-[3-[(3-hydroxy-2,2-dimethyl-3-phenylpropanoyl)amino]prop-1-ynyl]-6,6-dimethyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3R,7S,7aR)-3-tert-butyl-7-hydroxy-7-[3-[(3-hydroxy-2,2-dimethyl-3-phenylpropanoyl)amino]prop-1-ynyl]-6,6-dimethyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 46884694 |
| Molecular Formula | C28H38N2O7 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | methyl (3R,7S,7aR)-3-tert-butyl-7-hydroxy-7-[3-[(3-hydroxy-2,2-dimethyl-3-phenylpropanoyl)amino]prop-1-ynyl]-6,6-dimethyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)C(C)(C)[C@@]2(O)C#CCNC(=O)C(C)(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C28H38N2O7/c1-24(2,3)22-30-21(33)26(6,7)28(35,27(30,17-37-22)23(34)36-8)15-12-16-29-20(32)25(4,5)19(31)18-13-10-9-11-14-18/h9-11,13-14,19,22,31,35H,16-17H2,1-8H3,(H,29,32)/t19?,22-,27+,28+/m1/s1 |
| InChIKey | UGLJIURGOLRQDW-ISFPMRQPSA-N |
| XLogP | 1.78 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|