About 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine
2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine (PubChem CID 46885007) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine |
| PubChem CID | 46885007 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine |
| SMILES | COc1nc(C)c2c(n1)OCC2 |
| InChI | InChI=1S/C8H10N2O2/c1-5-6-3-4-12-7(6)10-8(9-5)11-2/h3-4H2,1-2H3 |
| InChIKey | QXENHPGHDBLMSG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine?
The IUPAC name of 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine (CID 46885007) is 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine.
What is the SMILES notation for 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine?
The canonical SMILES for 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine is COc1nc(C)c2c(n1)OCC2.
What is the InChIKey of 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine?
The InChIKey is QXENHPGHDBLMSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-5-6-3-4-12-7(6)10-8(9-5)11-2/h3-4H2,1-2H3.
What are the key properties of 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine?
2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine has a molecular weight of 166.18 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine is sourced from PubChem (CID 46885007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).