C34H39N3O4 — CID 46885249
N-methyl-4-[8-(5-methyl-2,4-dioxopyrimidin-1-yl)octoxy-diphenylmethyl]benzamide (PubChem CID 46885249) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is N-methyl-4-[8-(5-methyl-2,4-dioxopyrimidin-1-yl)octoxy-diphenylmethyl]benzamide.
| Compound Name | N-methyl-4-[8-(5-methyl-2,4-dioxopyrimidin-1-yl)octoxy-diphenylmethyl]benzamide |
|---|---|
| PubChem CID | 46885249 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | N-methyl-4-[8-(5-methyl-2,4-dioxopyrimidin-1-yl)octoxy-diphenylmethyl]benzamide |
| SMILES | CNC(=O)c1ccc(C(OCCCCCCCCn2cc(C)c(=O)[nH]c2=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H39N3O4/c1-26-25-37(33(40)36-31(26)38)23-13-5-3-4-6-14-24-41-34(28-15-9-7-10-16-28,29-17-11-8-12-18-29)30-21-19-27(20-22-30)32(39)35-2/h7-12,15-22,25H,3-6,13-14,23-24H2,1-2H3,(H,35,39)(H,36,38,40) |
| InChIKey | DCWTXUPXSKUDBK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|