C32H39N9O3 — CID 46885274
1-[4-[4,6-bis(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3,5-triazin-2-yl]phenyl]-3-(4-piperazin-1-ylphenyl)urea (PubChem CID 46885274) has the molecular formula C32H39N9O3 and a molecular weight of 597.72 g/mol. Its IUPAC name is 1-[4-[4,6-bis(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3,5-triazin-2-yl]phenyl]-3-(4-piperazin-1-ylphenyl)urea.
| Compound Name | 1-[4-[4,6-bis(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3,5-triazin-2-yl]phenyl]-3-(4-piperazin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 46885274 |
| Molecular Formula | C32H39N9O3 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | 1-[4-[4,6-bis(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3,5-triazin-2-yl]phenyl]-3-(4-piperazin-1-ylphenyl)urea |
| SMILES | O=C(Nc1ccc(-c2nc(N3C4CCC3COC4)nc(N3C4CCC3COC4)n2)cc1)Nc1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C32H39N9O3/c42-32(35-23-5-7-24(8-6-23)39-15-13-33-14-16-39)34-22-3-1-21(2-4-22)29-36-30(40-25-9-10-26(40)18-43-17-25)38-31(37-29)41-27-11-12-28(41)20-44-19-27/h1-8,25-28,33H,9-20H2,(H2,34,35,42) |
| InChIKey | OLSXUWDWUPKCRO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|