About 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid
2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid (PubChem CID 46885311) has the molecular formula C25H26F2N2O2
and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid |
| PubChem CID | 46885311 |
| Molecular Formula | C25H26F2N2O2 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1-c1ccc(CCc2ncc(CC3CCCCC3)[nH]2)cc1 |
| InChI | InChI=1S/C25H26F2N2O2/c26-22-13-20(21(25(30)31)14-23(22)27)18-9-6-16(7-10-18)8-11-24-28-15-19(29-24)12-17-4-2-1-3-5-17/h6-7,9-10,13-15,17H,1-5,8,11-12H2,(H,28,29)(H,30,31) |
| InChIKey | WRTOIQWQOCBQCT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid?
The IUPAC name of 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid (CID 46885311) is 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid.
What is the SMILES notation for 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid?
The canonical SMILES for 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid is O=C(O)c1cc(F)c(F)cc1-c1ccc(CCc2ncc(CC3CCCCC3)[nH]2)cc1.
What is the InChIKey of 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid?
The InChIKey is WRTOIQWQOCBQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26F2N2O2/c26-22-13-20(21(25(30)31)14-23(22)27)18-9-6-16(7-10-18)8-11-24-28-15-19(29-24)12-17-4-2-1-3-5-17/h6-7,9-10,13-15,17H,1-5,8,11-12H2,(H,28,29)(H,30,31).
What are the key properties of 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid?
2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid has a molecular weight of 424.49 g/mol, XLogP of 5.96, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-[5-(cyclohexylmethyl)-1H-imidazol-2-yl]ethyl]phenyl]-4,5-difluorobenzoic acid is sourced from PubChem (CID 46885311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).