About 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid
6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid (PubChem CID 46885313) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid |
| PubChem CID | 46885313 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid |
| SMILES | CCC(C)(C)Cc1cnc(CCc2ccc(-c3cccc(C(=O)O)n3)cc2)[nH]1 |
| InChI | InChI=1S/C23H27N3O2/c1-4-23(2,3)14-18-15-24-21(25-18)13-10-16-8-11-17(12-9-16)19-6-5-7-20(26-19)22(27)28/h5-9,11-12,15H,4,10,13-14H2,1-3H3,(H,24,25)(H,27,28) |
| InChIKey | ZCNDXFIXQKOLSQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid?
The IUPAC name of 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid (CID 46885313) is 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid is CCC(C)(C)Cc1cnc(CCc2ccc(-c3cccc(C(=O)O)n3)cc2)[nH]1.
What is the InChIKey of 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid?
The InChIKey is ZCNDXFIXQKOLSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-4-23(2,3)14-18-15-24-21(25-18)13-10-16-8-11-17(12-9-16)19-6-5-7-20(26-19)22(27)28/h5-9,11-12,15H,4,10,13-14H2,1-3H3,(H,24,25)(H,27,28).
What are the key properties of 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid?
6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid has a molecular weight of 377.49 g/mol, XLogP of 4.93, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 46885313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).