C24H26F4N2O2 — CID 46885326
[(3R,5S)-4-(3,4-difluorophenyl)-4-hydroxy-3,5-dimethylpiperidin-1-yl]-[(3S,4R)-4-(2,4-difluorophenyl)pyrrolidin-3-yl]methanone (PubChem CID 46885326) has the molecular formula C24H26F4N2O2 and a molecular weight of 450.48 g/mol. Its IUPAC name is [(3R,5S)-4-(3,4-difluorophenyl)-4-hydroxy-3,5-dimethylpiperidin-1-yl]-[(3S,4R)-4-(2,4-difluorophenyl)pyrrolidin-3-yl]methanone.
| Compound Name | [(3R,5S)-4-(3,4-difluorophenyl)-4-hydroxy-3,5-dimethylpiperidin-1-yl]-[(3S,4R)-4-(2,4-difluorophenyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 46885326 |
| Molecular Formula | C24H26F4N2O2 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [(3R,5S)-4-(3,4-difluorophenyl)-4-hydroxy-3,5-dimethylpiperidin-1-yl]-[(3S,4R)-4-(2,4-difluorophenyl)pyrrolidin-3-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)[C@@H]2CNC[C@H]2c2ccc(F)cc2F)C[C@H](C)C1(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H26F4N2O2/c1-13-11-30(12-14(2)24(13,32)15-3-6-20(26)22(28)7-15)23(31)19-10-29-9-18(19)17-5-4-16(25)8-21(17)27/h3-8,13-14,18-19,29,32H,9-12H2,1-2H3/t13-,14+,18-,19+,24?/m0/s1 |
| InChIKey | FHCVSUWWTUKUEF-RRKGENMQSA-N |
| XLogP | 3.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |