C17H14N6O2S — CID 46885403
N-[2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-phenylacetamide (PubChem CID 46885403) has the molecular formula C17H14N6O2S and a molecular weight of 366.41 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-phenylacetamide.
| Compound Name | N-[2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 46885403 |
| Molecular Formula | C17H14N6O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-phenylacetamide |
| SMILES | CSc1nc(NC(=O)Cc2ccccc2)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C17H14N6O2S/c1-26-17-20-15(18-13(24)10-11-6-3-2-4-7-11)23-16(21-17)19-14(22-23)12-8-5-9-25-12/h2-9H,10H2,1H3,(H,18,19,20,21,22,24) |
| InChIKey | OCMKXBYNWNGRGY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |