C18H16N6O3S — CID 46885404
N-[2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-(4-methoxyphenyl)acetamide (PubChem CID 46885404) has the molecular formula C18H16N6O3S and a molecular weight of 396.43 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46885404 |
| Molecular Formula | C18H16N6O3S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[2-(furan-2-yl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nc(SC)nc3nc(-c4ccco4)nn23)cc1 |
| InChI | InChI=1S/C18H16N6O3S/c1-26-12-7-5-11(6-8-12)10-14(25)19-16-21-18(28-2)22-17-20-15(23-24(16)17)13-4-3-9-27-13/h3-9H,10H2,1-2H3,(H,19,20,21,22,23,25) |
| InChIKey | HAHUTUCPPSBANJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |