C18H22N4O3 — CID 46885479
(3S)-2-[(2S)-2-amino-2-pyrrolidin-2-ylacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 46885479) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is (3S)-2-[(2S)-2-amino-2-pyrrolidin-2-ylacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (3S)-2-[(2S)-2-amino-2-pyrrolidin-2-ylacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 46885479 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3S)-2-[(2S)-2-amino-2-pyrrolidin-2-ylacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | N[C@H](C(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)O)C1CCCN1 |
| InChI | InChI=1S/C18H22N4O3/c19-16(13-6-3-7-20-13)17(23)22-9-14-11(8-15(22)18(24)25)10-4-1-2-5-12(10)21-14/h1-2,4-5,13,15-16,20-21H,3,6-9,19H2,(H,24,25)/t13?,15-,16-/m0/s1 |
| InChIKey | JAWUYDZZAALLAM-FMYDAXTQSA-N |
| XLogP | 0.59 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|