About (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one
(2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 46885534) has the molecular formula C22H14N2O4
and a molecular weight of 370.36 g/mol. Its IUPAC name is (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one.
Molecular Properties
| Compound Name | (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one |
| PubChem CID | 46885534 |
| Molecular Formula | C22H14N2O4 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2c(-c3ccccn3)[nH]c3ccccc23)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C22H14N2O4/c25-12-9-17(26)20-18(10-12)28-19(22(20)27)11-14-13-5-1-2-6-15(13)24-21(14)16-7-3-4-8-23-16/h1-11,24-26H/b19-11- |
| InChIKey | HGJGUYNOVGVHDX-ODLFYWEKSA-N |
| XLogP | 4.26 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The IUPAC name of (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one (CID 46885534) is (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one.
What is the SMILES notation for (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The canonical SMILES for (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one is O=C1/C(=C/c2c(-c3ccccn3)[nH]c3ccccc23)Oc2cc(O)cc(O)c21.
What is the InChIKey of (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The InChIKey is HGJGUYNOVGVHDX-ODLFYWEKSA-N. The full InChI is InChI=1S/C22H14N2O4/c25-12-9-17(26)20-18(10-12)28-19(22(20)27)11-14-13-5-1-2-6-15(13)24-21(14)16-7-3-4-8-23-16/h1-11,24-26H/b19-11-.
What are the key properties of (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
(2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one has a molecular weight of 370.36 g/mol, XLogP of 4.26, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4,6-dihydroxy-2-[(2-pyridin-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one is sourced from PubChem (CID 46885534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).