C18H18N8O2 — CID 46885588
1-[5-(dimethylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-3-(4-methylphenyl)urea (PubChem CID 46885588) has the molecular formula C18H18N8O2 and a molecular weight of 378.40 g/mol. Its IUPAC name is 1-[5-(dimethylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[5-(dimethylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 46885588 |
| Molecular Formula | C18H18N8O2 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[5-(dimethylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2nc(N(C)C)nc3nc(-c4ccco4)nn23)cc1 |
| InChI | InChI=1S/C18H18N8O2/c1-11-6-8-12(9-7-11)19-18(27)23-17-22-15(25(2)3)21-16-20-14(24-26(16)17)13-5-4-10-28-13/h4-10H,1-3H3,(H2,19,20,21,22,23,24,27) |
| InChIKey | QPLYILIGJGWUDW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |