C27H32F4N2O2 — CID 46885622
[(3S,5R)-4-(2,4-difluorophenyl)-4-hydroxy-3,5-dimethylpiperidin-1-yl]-[(3S,4R)-4-(2,4-difluorophenyl)-1-propan-2-ylpyrrolidin-3-yl]methanone (PubChem CID 46885622) has the molecular formula C27H32F4N2O2 and a molecular weight of 492.56 g/mol. Its IUPAC name is [(3S,5R)-4-(2,4-difluorophenyl)-4-hydroxy-3,5-dimethylpiperidin-1-yl]-[(3S,4R)-4-(2,4-difluorophenyl)-1-propan-2-ylpyrrolidin-3-yl]methanone.
| Compound Name | [(3S,5R)-4-(2,4-difluorophenyl)-4-hydroxy-3,5-dimethylpiperidin-1-yl]-[(3S,4R)-4-(2,4-difluorophenyl)-1-propan-2-ylpyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 46885622 |
| Molecular Formula | C27H32F4N2O2 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(3S,5R)-4-(2,4-difluorophenyl)-4-hydroxy-3,5-dimethylpiperidin-1-yl]-[(3S,4R)-4-(2,4-difluorophenyl)-1-propan-2-ylpyrrolidin-3-yl]methanone |
| SMILES | CC(C)N1C[C@@H](C(=O)N2C[C@@H](C)C(O)(c3ccc(F)cc3F)[C@@H](C)C2)[C@H](c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C27H32F4N2O2/c1-15(2)32-13-21(20-7-5-18(28)9-24(20)30)22(14-32)26(34)33-11-16(3)27(35,17(4)12-33)23-8-6-19(29)10-25(23)31/h5-10,15-17,21-22,35H,11-14H2,1-4H3/t16-,17+,21-,22+,27?/m0/s1 |
| InChIKey | MORUGIDJKBNFMS-ADTNHLOGSA-N |
| XLogP | 4.67 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |