C13H18N2O11P2S — CID 46885685
[5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-1-phosphonopentyl]phosphonic acid (PubChem CID 46885685) has the molecular formula C13H18N2O11P2S and a molecular weight of 472.31 g/mol. Its IUPAC name is [5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-1-phosphonopentyl]phosphonic acid.
| Compound Name | [5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-1-phosphonopentyl]phosphonic acid |
|---|---|
| PubChem CID | 46885685 |
| Molecular Formula | C13H18N2O11P2S |
| Molecular Weight | 472.31 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | [5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-1-phosphonopentyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CCCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C13H18N2O11P2S/c16-15-13(29(23,24)10-6-2-1-3-7-10)12(14-26-15)25-9-5-4-8-11(27(17,18)19)28(20,21)22/h1-3,6-7,11H,4-5,8-9H2,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | UUOOWCLJIBYCCS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 211.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|