C15H19N3O5 — CID 46885769
(2R,3R,4S,5R,6R)-2-methoxy-6-[(4-phenyltriazol-1-yl)methyl]oxane-3,4,5-triol (PubChem CID 46885769) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-methoxy-6-[(4-phenyltriazol-1-yl)methyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-methoxy-6-[(4-phenyltriazol-1-yl)methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46885769 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-methoxy-6-[(4-phenyltriazol-1-yl)methyl]oxane-3,4,5-triol |
| SMILES | CO[C@@H]1O[C@H](Cn2cc(-c3ccccc3)nn2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H19N3O5/c1-22-15-14(21)13(20)12(19)11(23-15)8-18-7-10(16-17-18)9-5-3-2-4-6-9/h2-7,11-15,19-21H,8H2,1H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | ISPPIGSTMGYXLK-GZBLMMOJSA-N |
| XLogP | -0.60 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |