About N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide
N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide (PubChem CID 46885794) has the molecular formula C11H9N3O3
and a molecular weight of 231.21 g/mol. Its IUPAC name is N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide |
| PubChem CID | 46885794 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide |
| SMILES | CC(=O)NC1=CC(=O)c2cnc(C)nc2C1=O |
| InChI | InChI=1S/C11H9N3O3/c1-5-12-4-7-9(16)3-8(14-6(2)15)11(17)10(7)13-5/h3-4H,1-2H3,(H,14,15) |
| InChIKey | DMENLIVYSFIEHN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide?
The IUPAC name of N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide (CID 46885794) is N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide.
What is the SMILES notation for N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide?
The canonical SMILES for N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide is CC(=O)NC1=CC(=O)c2cnc(C)nc2C1=O.
What is the InChIKey of N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide?
The InChIKey is DMENLIVYSFIEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O3/c1-5-12-4-7-9(16)3-8(14-6(2)15)11(17)10(7)13-5/h3-4H,1-2H3,(H,14,15).
What are the key properties of N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide?
N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide has a molecular weight of 231.21 g/mol, XLogP of 0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-5,8-dioxoquinazolin-7-yl)acetamide is sourced from PubChem (CID 46885794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).