C26H16Cl2F2N2O4S2 — CID 46885882
(E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[3,3-difluoro-1-(naphthalen-2-ylmethyl)-2-oxoindol-7-yl]prop-2-enamide (PubChem CID 46885882) has the molecular formula C26H16Cl2F2N2O4S2 and a molecular weight of 593.46 g/mol. Its IUPAC name is (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[3,3-difluoro-1-(naphthalen-2-ylmethyl)-2-oxoindol-7-yl]prop-2-enamide.
| Compound Name | (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[3,3-difluoro-1-(naphthalen-2-ylmethyl)-2-oxoindol-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 46885882 |
| Molecular Formula | C26H16Cl2F2N2O4S2 |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 591.99 |
| IUPAC Name | (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[3,3-difluoro-1-(naphthalen-2-ylmethyl)-2-oxoindol-7-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2c1N(Cc1ccc3ccccc3c1)C(=O)C2(F)F)NS(=O)(=O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C26H16Cl2F2N2O4S2/c27-20-13-22(37-24(20)28)38(35,36)31-21(33)11-10-17-6-3-7-19-23(17)32(25(34)26(19,29)30)14-15-8-9-16-4-1-2-5-18(16)12-15/h1-13H,14H2,(H,31,33)/b11-10+ |
| InChIKey | RZWWSHIRKIGVTP-ZHACJKMWSA-N |
| XLogP | 6.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|