C24H28O5 — CID 46885884
(1S,2R,6S,7R)-8-[(E)-2-[(1S,4aS,8aR)-2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethenyl]-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 46885884) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is (1S,2R,6S,7R)-8-[(E)-2-[(1S,4aS,8aR)-2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethenyl]-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-8-[(E)-2-[(1S,4aS,8aR)-2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethenyl]-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 46885884 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (1S,2R,6S,7R)-8-[(E)-2-[(1S,4aS,8aR)-2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethenyl]-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1=CC(=O)[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1/C=C/C1=C[C@@H]2O[C@@H]1[C@H]1C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C24H28O5/c1-12-10-15(25)20-23(2,3)8-5-9-24(20,4)14(12)7-6-13-11-16-17-18(19(13)28-16)22(27)29-21(17)26/h6-7,10-11,14,16-20H,5,8-9H2,1-4H3/b7-6+/t14-,16-,17-,18-,19-,20-,24+/m0/s1 |
| InChIKey | WKGJKGLZMOYISD-WHDUIXCXSA-N |
| XLogP | 3.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|