C18H26N4O5 — CID 46885909
(2R,3R,4S,5R,6R)-2-[[4-[benzyl(ethyl)amino]triazol-1-yl]methyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 46885909) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[[4-[benzyl(ethyl)amino]triazol-1-yl]methyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[[4-[benzyl(ethyl)amino]triazol-1-yl]methyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 46885909 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[[4-[benzyl(ethyl)amino]triazol-1-yl]methyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CCN(Cc1ccccc1)c1cn(C[C@H]2O[C@@H](OC)[C@H](O)[C@@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C18H26N4O5/c1-3-21(9-12-7-5-4-6-8-12)14-11-22(20-19-14)10-13-15(23)16(24)17(25)18(26-2)27-13/h4-8,11,13,15-18,23-25H,3,9-10H2,1-2H3/t13-,15+,16+,17-,18-/m1/s1 |
| InChIKey | WXYOTMQYMNYVEZ-PLLDYVMSSA-N |
| XLogP | -0.24 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |