C16H8IN5OS2 — CID 46885992
4-(furan-2-yl)-10-(3-iodophenyl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-11-thione (PubChem CID 46885992) has the molecular formula C16H8IN5OS2 and a molecular weight of 477.31 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-(3-iodophenyl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-11-thione.
| Compound Name | 4-(furan-2-yl)-10-(3-iodophenyl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-11-thione |
|---|---|
| PubChem CID | 46885992 |
| Molecular Formula | C16H8IN5OS2 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.92 |
| IUPAC Name | 4-(furan-2-yl)-10-(3-iodophenyl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-11-thione |
| SMILES | S=c1sc2c(ncn3nc(-c4ccco4)nc23)n1-c1cccc(I)c1 |
| InChI | InChI=1S/C16H8IN5OS2/c17-9-3-1-4-10(7-9)22-14-12(25-16(22)24)15-19-13(11-5-2-6-23-11)20-21(15)8-18-14/h1-8H |
| InChIKey | GCWWPUIDBLGEII-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|