C24H33NO2 — CID 46886030
(4S,4aR,8aS)-4-[(E)-2-(2,3,3a,4,7,7a-hexahydro-1H-4,7-epoxyisoindol-5-yl)ethenyl]-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-4H-naphthalen-1-one (PubChem CID 46886030) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (4S,4aR,8aS)-4-[(E)-2-(2,3,3a,4,7,7a-hexahydro-1H-4,7-epoxyisoindol-5-yl)ethenyl]-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-4H-naphthalen-1-one.
| Compound Name | (4S,4aR,8aS)-4-[(E)-2-(2,3,3a,4,7,7a-hexahydro-1H-4,7-epoxyisoindol-5-yl)ethenyl]-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 46886030 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (4S,4aR,8aS)-4-[(E)-2-(2,3,3a,4,7,7a-hexahydro-1H-4,7-epoxyisoindol-5-yl)ethenyl]-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-4H-naphthalen-1-one |
| SMILES | CC1=CC(=O)[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1/C=C/C1=CC2OC1C1CNCC21 |
| InChI | InChI=1S/C24H33NO2/c1-14-10-19(26)22-23(2,3)8-5-9-24(22,4)18(14)7-6-15-11-20-16-12-25-13-17(16)21(15)27-20/h6-7,10-11,16-18,20-22,25H,5,8-9,12-13H2,1-4H3/b7-6+/t16?,17?,18-,20?,21?,22-,24+/m0/s1 |
| InChIKey | IVAYIQFBTMAVPQ-YRKPIVKHSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |