C22H20N2O4 — CID 46886110
5-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,2-dihydropyrazol-3-one (PubChem CID 46886110) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 5-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 46886110 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 5-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,2-dihydropyrazol-3-one |
| SMILES | COc1cc(-c2c(-c3ccc4ccccc4c3)[nH][nH]c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H20N2O4/c1-26-17-11-16(12-18(27-2)21(17)28-3)19-20(23-24-22(19)25)15-9-8-13-6-4-5-7-14(13)10-15/h4-12H,1-3H3,(H2,23,24,25) |
| InChIKey | XBYPUXHHORJEPO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |