C16H14N6OS — CID 46886169
13-amino-11-(methylamino)-5-(4-methylphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 46886169) has the molecular formula C16H14N6OS and a molecular weight of 338.40 g/mol. Its IUPAC name is 13-amino-11-(methylamino)-5-(4-methylphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-amino-11-(methylamino)-5-(4-methylphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 46886169 |
| Molecular Formula | C16H14N6OS |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 13-amino-11-(methylamino)-5-(4-methylphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | CNc1nc(N)c2c(n1)sc1c(=O)n(-c3ccc(C)cc3)cnc12 |
| InChI | InChI=1S/C16H14N6OS/c1-8-3-5-9(6-4-8)22-7-19-11-10-13(17)20-16(18-2)21-14(10)24-12(11)15(22)23/h3-7H,1-2H3,(H3,17,18,20,21) |
| InChIKey | BJPPTGLQJGWMJU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |