C33H35N7O2S — CID 46886315
2-cyclohexyl-N-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]acetamide (PubChem CID 46886315) has the molecular formula C33H35N7O2S and a molecular weight of 593.76 g/mol. Its IUPAC name is 2-cyclohexyl-N-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 46886315 |
| Molecular Formula | C33H35N7O2S |
| Molecular Weight | 593.76 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 2-cyclohexyl-N-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]acetamide |
| SMILES | O=C(CC1CCCCC1)Nc1cccc(-c2nc3sccn3c2-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C33H35N7O2S/c41-29(21-23-5-2-1-3-6-23)35-26-8-4-7-24(22-26)30-31(40-17-20-43-33(40)38-30)28-13-14-34-32(37-28)36-25-9-11-27(12-10-25)39-15-18-42-19-16-39/h4,7-14,17,20,22-23H,1-3,5-6,15-16,18-19,21H2,(H,35,41)(H,34,36,37) |
| InChIKey | UUPXLBHSXVXULD-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|