C36H55N3O6 — CID 46886421
N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1-hydroxy-2,2,5,5-tetramethylpyrrole-3-carboxamide (PubChem CID 46886421) has the molecular formula C36H55N3O6 and a molecular weight of 625.85 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1-hydroxy-2,2,5,5-tetramethylpyrrole-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1-hydroxy-2,2,5,5-tetramethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46886421 |
| Molecular Formula | C36H55N3O6 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.41 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1-hydroxy-2,2,5,5-tetramethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(CCN(C)CCCC(CNC(=O)C2=CC(C)(C)N(O)C2(C)C)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C36H55N3O6/c1-25(2)36(27-14-16-30(43-9)32(22-27)45-11,24-37-33(40)28-23-34(3,4)39(41)35(28,5)6)18-12-19-38(7)20-17-26-13-15-29(42-8)31(21-26)44-10/h13-16,21-23,25,41H,12,17-20,24H2,1-11H3,(H,37,40) |
| InChIKey | KRXRRXMBTCTFSD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |