C37H57N3O5 — CID 46886424
N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1,2,2,5,5-pentamethylpyrrole-3-carboxamide (PubChem CID 46886424) has the molecular formula C37H57N3O5 and a molecular weight of 623.88 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1,2,2,5,5-pentamethylpyrrole-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1,2,2,5,5-pentamethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46886424 |
| Molecular Formula | C37H57N3O5 |
| Molecular Weight | 623.88 g/mol |
| Exact Mass | 623.43 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentyl]-1,2,2,5,5-pentamethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(CCN(C)CCCC(CNC(=O)C2=CC(C)(C)N(C)C2(C)C)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C37H57N3O5/c1-26(2)37(28-15-17-31(43-10)33(23-28)45-12,25-38-34(41)29-24-35(3,4)40(8)36(29,5)6)19-13-20-39(7)21-18-27-14-16-30(42-9)32(22-27)44-11/h14-17,22-24,26H,13,18-21,25H2,1-12H3,(H,38,41) |
| InChIKey | FLZIGWGEPLAQCW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.88 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |