C36H40N10O6 — CID 46886597
6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-(pyridin-2-ylmethylcarbamoylamino)ethyl]purine-2-carboxamide (PubChem CID 46886597) has the molecular formula C36H40N10O6 and a molecular weight of 708.78 g/mol. Its IUPAC name is 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-(pyridin-2-ylmethylcarbamoylamino)ethyl]purine-2-carboxamide.
| Compound Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-(pyridin-2-ylmethylcarbamoylamino)ethyl]purine-2-carboxamide |
|---|---|
| PubChem CID | 46886597 |
| Molecular Formula | C36H40N10O6 |
| Molecular Weight | 708.78 g/mol |
| Exact Mass | 708.31 |
| IUPAC Name | 6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]-N-[2-(pyridin-2-ylmethylcarbamoylamino)ethyl]purine-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)NCCNC(=O)NCc4ccccn4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C36H40N10O6/c1-2-37-33(49)29-27(47)28(48)35(52-29)46-21-43-26-30(41-20-25(22-11-5-3-6-12-22)23-13-7-4-8-14-23)44-31(45-32(26)46)34(50)39-17-18-40-36(51)42-19-24-15-9-10-16-38-24/h3-16,21,25,27-29,35,47-48H,2,17-20H2,1H3,(H,37,49)(H,39,50)(H2,40,42,51)(H,41,44,45)/t27-,28+,29-,35+/m0/s1 |
| InChIKey | ZLDNGTPGRKLXMI-LQHHRKQYSA-N |
| XLogP | 1.45 |
| TPSA | 217.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.78 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|