C18H15F2N5O4 — CID 46886672
1-(2-cyclopropylethyl)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 46886672) has the molecular formula C18H15F2N5O4 and a molecular weight of 403.35 g/mol. Its IUPAC name is 1-(2-cyclopropylethyl)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 1-(2-cyclopropylethyl)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 46886672 |
| Molecular Formula | C18H15F2N5O4 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-(2-cyclopropylethyl)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | Cn1c(=O)nc2n(CCC3CC3)nc(-c3ccc4c(c3)OC(F)(F)O4)nc-2c1=O |
| InChI | InChI=1S/C18H15F2N5O4/c1-24-16(26)13-15(22-17(24)27)25(7-6-9-2-3-9)23-14(21-13)10-4-5-11-12(8-10)29-18(19,20)28-11/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | FRXKRGBPZHALTB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |