C21H36O5 — CID 46886694
2-[(3R,4R,6S)-4,6-diethyl-6-[(E,2S,4R)-4-ethyl-2-methyl-7-oxooct-5-enyl]dioxan-3-yl]acetic acid (PubChem CID 46886694) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-[(3R,4R,6S)-4,6-diethyl-6-[(E,2S,4R)-4-ethyl-2-methyl-7-oxooct-5-enyl]dioxan-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R,6S)-4,6-diethyl-6-[(E,2S,4R)-4-ethyl-2-methyl-7-oxooct-5-enyl]dioxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 46886694 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 2-[(3R,4R,6S)-4,6-diethyl-6-[(E,2S,4R)-4-ethyl-2-methyl-7-oxooct-5-enyl]dioxan-3-yl]acetic acid |
| SMILES | CCC(/C=C/C(C)=O)C[C@H](C)C[C@@]1(CC)C[C@@H](CC)[C@@H](CC(=O)O)OO1 |
| InChI | InChI=1S/C21H36O5/c1-6-17(10-9-16(5)22)11-15(4)13-21(8-3)14-18(7-2)19(25-26-21)12-20(23)24/h9-10,15,17-19H,6-8,11-14H2,1-5H3,(H,23,24)/b10-9+/t15-,17?,18+,19+,21-/m0/s1 |
| InChIKey | HFHDSLLYEQXICI-XVIBASAMSA-N |
| XLogP | 4.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|