C18H32O6 — CID 46886695
(2R,4S)-5-[(3S,5R,6R)-6-(carboxymethyl)-3,5-diethyldioxan-3-yl]-2-ethyl-4-methylpentanoic acid (PubChem CID 46886695) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is (2R,4S)-5-[(3S,5R,6R)-6-(carboxymethyl)-3,5-diethyldioxan-3-yl]-2-ethyl-4-methylpentanoic acid.
| Compound Name | (2R,4S)-5-[(3S,5R,6R)-6-(carboxymethyl)-3,5-diethyldioxan-3-yl]-2-ethyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 46886695 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (2R,4S)-5-[(3S,5R,6R)-6-(carboxymethyl)-3,5-diethyldioxan-3-yl]-2-ethyl-4-methylpentanoic acid |
| SMILES | CCC(C[C@H](C)C[C@@]1(CC)C[C@@H](CC)[C@@H](CC(=O)O)OO1)C(=O)O |
| InChI | InChI=1S/C18H32O6/c1-5-13(17(21)22)8-12(4)10-18(7-3)11-14(6-2)15(23-24-18)9-16(19)20/h12-15H,5-11H2,1-4H3,(H,19,20)(H,21,22)/t12-,13?,14+,15+,18-/m0/s1 |
| InChIKey | CQXMTSDUBPWSJN-KBGUAKCSSA-N |
| XLogP | 3.88 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|