C10H14O5 — CID 46886739
(1R,3S,4S,6R,7S,10S)-4-hydroxy-10-(hydroxymethyl)-3-methyl-2,9-dioxatricyclo[4.3.1.03,7]decan-8-one (PubChem CID 46886739) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (1R,3S,4S,6R,7S,10S)-4-hydroxy-10-(hydroxymethyl)-3-methyl-2,9-dioxatricyclo[4.3.1.03,7]decan-8-one.
| Compound Name | (1R,3S,4S,6R,7S,10S)-4-hydroxy-10-(hydroxymethyl)-3-methyl-2,9-dioxatricyclo[4.3.1.03,7]decan-8-one |
|---|---|
| PubChem CID | 46886739 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1R,3S,4S,6R,7S,10S)-4-hydroxy-10-(hydroxymethyl)-3-methyl-2,9-dioxatricyclo[4.3.1.03,7]decan-8-one |
| SMILES | C[C@]12O[C@@H]3OC(=O)[C@H]1[C@H](C[C@@H]2O)[C@@H]3CO |
| InChI | InChI=1S/C10H14O5/c1-10-6(12)2-4-5(3-11)9(15-10)14-8(13)7(4)10/h4-7,9,11-12H,2-3H2,1H3/t4-,5+,6+,7-,9+,10-/m1/s1 |
| InChIKey | ATFJUGCMEQBNLH-ZMMQRQPWSA-N |
| XLogP | -0.74 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |