C22H34O4 — CID 46886860
[(1R,2Z,4S)-4-acetyloxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 46886860) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1R,2Z,4S)-4-acetyloxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2Z,4S)-4-acetyloxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 46886860 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1R,2Z,4S)-4-acetyloxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1CC=C(C)CCCC(C)(C)[C@@H](OC(C)=O)/C=C\1C |
| InChI | InChI=1S/C22H34O4/c1-8-16(3)21(24)26-19-12-11-15(2)10-9-13-22(6,7)20(14-17(19)4)25-18(5)23/h8,11,14,19-20H,9-10,12-13H2,1-7H3/b15-11?,16-8-,17-14-/t19-,20+/m1/s1 |
| InChIKey | DJZAMDRFIUQAJH-PPWWNSHQSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|