C23H18I2N4O3 — CID 4688701
N-[(4-iodophenyl)methylideneamino]-2-[2-[2-[(4-iodophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide (PubChem CID 4688701) has the molecular formula C23H18I2N4O3 and a molecular weight of 652.23 g/mol. Its IUPAC name is N-[(4-iodophenyl)methylideneamino]-2-[2-[2-[(4-iodophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide.
| Compound Name | N-[(4-iodophenyl)methylideneamino]-2-[2-[2-[(4-iodophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 4688701 |
| Molecular Formula | C23H18I2N4O3 |
| Molecular Weight | 652.23 g/mol |
| Exact Mass | 651.95 |
| IUPAC Name | N-[(4-iodophenyl)methylideneamino]-2-[2-[2-[(4-iodophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)NN=Cc1ccc(I)cc1)NN=Cc1ccc(I)cc1 |
| InChI | InChI=1S/C23H18I2N4O3/c24-18-9-5-16(6-10-18)13-26-28-22(30)15-32-21-4-2-1-3-20(21)23(31)29-27-14-17-7-11-19(25)12-8-17/h1-14H,15H2,(H,28,30)(H,29,31) |
| InChIKey | KQOCEZMHZDBSJX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|