C19H22F3N9O2 — CID 46887034
4-[3-ethyl-7-(pyrimidin-4-ylamino)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-5-yl]piperazin-2-one (PubChem CID 46887034) has the molecular formula C19H22F3N9O2 and a molecular weight of 465.44 g/mol. Its IUPAC name is 4-[3-ethyl-7-(pyrimidin-4-ylamino)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-5-yl]piperazin-2-one.
| Compound Name | 4-[3-ethyl-7-(pyrimidin-4-ylamino)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-5-yl]piperazin-2-one |
|---|---|
| PubChem CID | 46887034 |
| Molecular Formula | C19H22F3N9O2 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 4-[3-ethyl-7-(pyrimidin-4-ylamino)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-5-yl]piperazin-2-one |
| SMILES | CCc1nn(CCOCC(F)(F)F)c2c(Nc3ccncn3)nc(N3CCNC(=O)C3)nc12 |
| InChI | InChI=1S/C19H22F3N9O2/c1-2-12-15-16(31(29-12)7-8-33-10-19(20,21)22)17(26-13-3-4-23-11-25-13)28-18(27-15)30-6-5-24-14(32)9-30/h3-4,11H,2,5-10H2,1H3,(H,24,32)(H,23,25,26,27,28) |
| InChIKey | KGOFUSVXUVEEPT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|