About 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide (PubChem CID 46887106) has the molecular formula C22H25N3O
and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide |
| PubChem CID | 46887106 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CC(=O)NC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O/c1-16-20(17(2)25(24-16)19-13-9-6-10-14-19)15-21(26)23-22(3,4)18-11-7-5-8-12-18/h5-14H,15H2,1-4H3,(H,23,26) |
| InChIKey | AAEDHMXIOGFEHG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide?
The IUPAC name of 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide (CID 46887106) is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide.
What is the SMILES notation for 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide?
The canonical SMILES for 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide is Cc1nn(-c2ccccc2)c(C)c1CC(=O)NC(C)(C)c1ccccc1.
What is the InChIKey of 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide?
The InChIKey is AAEDHMXIOGFEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O/c1-16-20(17(2)25(24-16)19-13-9-6-10-14-19)15-21(26)23-22(3,4)18-11-7-5-8-12-18/h5-14H,15H2,1-4H3,(H,23,26).
What are the key properties of 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide?
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide has a molecular weight of 347.46 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-phenylpropan-2-yl)acetamide is sourced from PubChem (CID 46887106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).