C24H20N6O2 — CID 46887139
8-(2-benzoylanilino)-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide (PubChem CID 46887139) has the molecular formula C24H20N6O2 and a molecular weight of 424.46 g/mol. Its IUPAC name is 8-(2-benzoylanilino)-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide.
| Compound Name | 8-(2-benzoylanilino)-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
|---|---|
| PubChem CID | 46887139 |
| Molecular Formula | C24H20N6O2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 8-(2-benzoylanilino)-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
| SMILES | Cn1nc(C(N)=O)c2c1-c1nc(Nc3ccccc3C(=O)c3ccccc3)ncc1CC2 |
| InChI | InChI=1S/C24H20N6O2/c1-30-21-17(20(29-30)23(25)32)12-11-15-13-26-24(28-19(15)21)27-18-10-6-5-9-16(18)22(31)14-7-3-2-4-8-14/h2-10,13H,11-12H2,1H3,(H2,25,32)(H,26,27,28) |
| InChIKey | NFRDZRLJAHUABL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|