C22H18FN5O — CID 4688727
13-butan-2-yl-17-(2-fluorophenyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 4688727) has the molecular formula C22H18FN5O and a molecular weight of 387.42 g/mol. Its IUPAC name is 13-butan-2-yl-17-(2-fluorophenyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 13-butan-2-yl-17-(2-fluorophenyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 4688727 |
| Molecular Formula | C22H18FN5O |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 13-butan-2-yl-17-(2-fluorophenyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | CCC(C)n1cnc2c(c1=O)c1nc3ccccc3nc1n2-c1ccccc1F |
| InChI | InChI=1S/C22H18FN5O/c1-3-13(2)27-12-24-20-18(22(27)29)19-21(26-16-10-6-5-9-15(16)25-19)28(20)17-11-7-4-8-14(17)23/h4-13H,3H2,1-2H3 |
| InChIKey | USINAIXLXQPXMV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |