C22H29NO6 — CID 46887391
(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-16-(propylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 46887391) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-16-(propylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-16-(propylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 46887391 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-4,5-dimethyl-16-(propylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | CCCNc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\[C@@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C22H29NO6/c1-4-10-23-16-11-15-6-5-7-17(24)21(27)18(25)9-8-13(2)14(3)29-22(28)20(15)19(26)12-16/h5-6,8-9,11-14,17,21,23-24,26-27H,4,7,10H2,1-3H3/b6-5+,9-8-/t13-,14+,17+,21+/m1/s1 |
| InChIKey | BBGXOWNNRZIFHR-XCYGIPCCSA-N |
| XLogP | 2.66 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |