C19H23NO6 — CID 46887392
(4S,5R,6Z,9S,10S,12E)-16-amino-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 46887392) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (4S,5R,6Z,9S,10S,12E)-16-amino-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,9S,10S,12E)-16-amino-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 46887392 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (4S,5R,6Z,9S,10S,12E)-16-amino-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(N)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C19H23NO6/c1-10-6-7-15(22)18(24)14(21)5-3-4-12-8-13(20)9-16(23)17(12)19(25)26-11(10)2/h3-4,6-11,14,18,21,23-24H,5,20H2,1-2H3/b4-3+,7-6-/t10-,11+,14+,18+/m1/s1 |
| InChIKey | MWUMPSGYUKJWIJ-LNOLQLJLSA-N |
| XLogP | 1.42 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|