C29H33N7O8 — CID 46887672
(2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[6-[[4-[[(3,4,5-trimethoxybenzoyl)amino]methyl]phenyl]methylamino]purin-9-yl]oxolane-2-carboxamide (PubChem CID 46887672) has the molecular formula C29H33N7O8 and a molecular weight of 607.62 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[6-[[4-[[(3,4,5-trimethoxybenzoyl)amino]methyl]phenyl]methylamino]purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[6-[[4-[[(3,4,5-trimethoxybenzoyl)amino]methyl]phenyl]methylamino]purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 46887672 |
| Molecular Formula | C29H33N7O8 |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[6-[[4-[[(3,4,5-trimethoxybenzoyl)amino]methyl]phenyl]methylamino]purin-9-yl]oxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4ccc(CNC(=O)c5cc(OC)c(OC)c(OC)c5)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H33N7O8/c1-30-28(40)24-21(37)22(38)29(44-24)36-14-35-20-25(33-13-34-26(20)36)31-11-15-5-7-16(8-6-15)12-32-27(39)17-9-18(41-2)23(43-4)19(10-17)42-3/h5-10,13-14,21-22,24,29,37-38H,11-12H2,1-4H3,(H,30,40)(H,32,39)(H,31,33,34)/t21-,22+,24-,29+/m0/s1 |
| InChIKey | GOASSFPKZZNPIH-UKNKTOQLSA-N |
| XLogP | 0.76 |
| TPSA | 191.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |