C18H14ClNO3 — CID 46887699
(2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)penta-2,4-dienamide (PubChem CID 46887699) has the molecular formula C18H14ClNO3 and a molecular weight of 327.77 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 46887699 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClNO3/c19-14-6-8-15(9-7-14)20-18(21)4-2-1-3-13-5-10-16-17(11-13)23-12-22-16/h1-11H,12H2,(H,20,21)/b3-1+,4-2+ |
| InChIKey | VAEHJHVYENQCDK-ZPUQHVIOSA-N |
| XLogP | 4.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|