C18H27NO2 — CID 46887731
4-methoxy-N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]benzamide (PubChem CID 46887731) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-methoxy-N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]benzamide.
| Compound Name | 4-methoxy-N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 46887731 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-methoxy-N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2C[C@H](C)CC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-12(2)16-10-5-13(3)11-17(16)19-18(20)14-6-8-15(21-4)9-7-14/h6-9,12-13,16-17H,5,10-11H2,1-4H3,(H,19,20)/t13-,16+,17-/m1/s1 |
| InChIKey | ABRBNROSGNKGSY-XOKHGSTOSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |