C17H24ClNO2 — CID 46887780
(4-chlorophenyl) N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]carbamate (PubChem CID 46887780) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is (4-chlorophenyl) N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]carbamate.
| Compound Name | (4-chlorophenyl) N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 46887780 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (4-chlorophenyl) N-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]carbamate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1NC(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H24ClNO2/c1-11(2)15-9-4-12(3)10-16(15)19-17(20)21-14-7-5-13(18)6-8-14/h5-8,11-12,15-16H,4,9-10H2,1-3H3,(H,19,20)/t12-,15+,16-/m1/s1 |
| InChIKey | PWGMGXOCMBFCFO-UHOFOFEASA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |